CAS 1867162-20-6 is the registry number for 6-Chloro-4-methylumbelliferyl beta-D-Xyloside. Offered by: TRC. Available pack sizes: 250mg.
6-chloro-4-methyl-7-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one (CAS 1867162-20-6) is a chemical compound with the molecular formula C15H15ClO7 and a molecular weight of 342.73 g/mol. IUPAC name: 6-chloro-4-methyl-7-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one. InChIKey: YOFHWXBULSBJDT-JGPDKYHGSA-N.
| Molecular formula | C15H15ClO7 |
|---|---|
| Molecular weight | 342.73 g/mol |
| IUPAC name | 6-chloro-4-methyl-7-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one |
| InChIKey | YOFHWXBULSBJDT-JGPDKYHGSA-N |
| SMILES | CC1=CC(=O)OC2=CC(=C(C=C12)Cl)O[C@H]3[C@@H](C([C@@H](CO3)O)O)O |
Computed by PubChem (NCBI)