CAS 1867272-80-7 is the registry number for (1R,3S,5R)-2-Azabicyclo(3.1.0)hexane-3-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide;hydrochloride (CAS 1867272-80-7) is a chemical compound with the molecular formula C6H11ClN2O and a molecular weight of 162.62 g/mol. IUPAC name: (1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide;hydrochloride. InChIKey: JFUDIEFZSNQJBS-ZDQHTEEMSA-N.
| Molecular formula | C6H11ClN2O |
|---|---|
| Molecular weight | 162.62 g/mol |
| IUPAC name | (1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide;hydrochloride |
| InChIKey | JFUDIEFZSNQJBS-ZDQHTEEMSA-N |
| SMILES | C1[C@H]2[C@@H]1N[C@@H](C2)C(=O)N.Cl |
Computed by PubChem (NCBI)