CAS 186796-08-7 appears in our catalog under these names: (S)-2-Acetamido-4-(((S)-1-methoxy-1-oxo-3-phenylpropan-2-yl)amino)-4-oxobutanoic acid, 98%, N-ACETYL-.BETA.-ASPARTAME, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg.
(2S)-2-acetamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (CAS 186796-08-7) is a chemical compound with the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. IUPAC name: (2S)-2-acetamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: GZMPVQQZFQXPFY-STQMWFEESA-N.
| Molecular formula | C16H20N2O6 |
|---|---|
| Molecular weight | 336.34 g/mol |
| IUPAC name | (2S)-2-acetamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | GZMPVQQZFQXPFY-STQMWFEESA-N |
| SMILES | CC(=O)N[C@@H](CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)