CAS 1868-48-0 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)-1,3,4-oxadiazole, 97%, 2,5–Bis(trifluoromethyl)–1,3,4–oxadiazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
2,5-bis(trifluoromethyl)-1,3,4-oxadiazole (CAS 1868-48-0) is a chemical compound with the molecular formula C4F6N2O and a molecular weight of 206.05 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)-1,3,4-oxadiazole. InChIKey: QJZONKZTJJLSQL-UHFFFAOYSA-N.
| Molecular formula | C4F6N2O |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)-1,3,4-oxadiazole |
| InChIKey | QJZONKZTJJLSQL-UHFFFAOYSA-N |
| SMILES | C1(=NN=C(O1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)