CAS 1868093-92-8 appears in our catalog under these names: Picoxystrobin Impurity 5, (alphaZ)-Methyl Ester alpha-(methoxymethylene)-2-(((6-(trifluoromethyl)-2-pyridinyl)oxy)methyl)-benzeneacetic Acid (Technical Grade). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (Z)-3-methoxy-2-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]phenyl]prop-2-enoate (CAS 1868093-92-8) is a chemical compound with the molecular formula C18H16F3NO4 and a molecular weight of 367.3 g/mol. IUPAC name: methyl (Z)-3-methoxy-2-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]phenyl]prop-2-enoate. InChIKey: IBSNKSODLGJUMQ-KAMYIIQDSA-N.
| Molecular formula | C18H16F3NO4 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | methyl (Z)-3-methoxy-2-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]phenyl]prop-2-enoate |
| InChIKey | IBSNKSODLGJUMQ-KAMYIIQDSA-N |
| SMILES | CO/C=C(/C1=CC=CC=C1COC2=CC=CC(=N2)C(F)(F)F)\C(=O)OC |
Computed by PubChem (NCBI)