CAS 18683-73-3 appears in our catalog under these names: Chlorpromazine Sulfone Hydrochloride, >95% (HPLC), Chlorpromazine Sulfone Hydrochloride. Offered by: TRC, Mikromol. Available pack sizes: 500mg, 50mg, 25mg.
3-(2-chloro-5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride (CAS 18683-73-3) is a chemical compound with the molecular formula C17H20Cl2N2O2S and a molecular weight of 387.3 g/mol. IUPAC name: 3-(2-chloro-5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: IANTWWZPQFMOTD-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2O2S |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | 3-(2-chloro-5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | IANTWWZPQFMOTD-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2S(=O)(=O)C3=C1C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)