CAS 18683-95-9 is the registry number for Ambroxol EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol (CAS 18683-95-9) is a chemical compound with the molecular formula C14H18Br2N2O and a molecular weight of 390.11 g/mol. IUPAC name: 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol. InChIKey: AJOQVCHLLULVGK-UHFFFAOYSA-N.
| Molecular formula | C14H18Br2N2O |
|---|---|
| Molecular weight | 390.11 g/mol |
| IUPAC name | 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol |
| InChIKey | AJOQVCHLLULVGK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O |
Computed by PubChem (NCBI)