Products 18683-95-9

CAS 18683-95-9 is the registry number for Ambroxol EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol (CAS 18683-95-9) is a chemical compound with the molecular formula C14H18Br2N2O and a molecular weight of 390.11 g/mol. IUPAC name: 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol. InChIKey: AJOQVCHLLULVGK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18Br2N2O
Molecular weight390.11 g/mol
IUPAC name4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol
InChIKeyAJOQVCHLLULVGK-UHFFFAOYSA-N
SMILESC1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O

Computed by PubChem (NCBI)