CAS 1868434-83-6 is the registry number for N-((1R,6S)-Bicyclo[4.1.0]heptan-2-yl)thietan-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1R,6S)-2-bicyclo[4.1.0]heptanyl]thietan-3-amine (CAS 1868434-83-6) is a chemical compound with the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. IUPAC name: N-[(1R,6S)-2-bicyclo[4.1.0]heptanyl]thietan-3-amine. InChIKey: WIVIQBKVPYDVAK-CEVVRISASA-N.
| Molecular formula | C10H17NS |
|---|---|
| Molecular weight | 183.32 g/mol |
| IUPAC name | N-[(1R,6S)-2-bicyclo[4.1.0]heptanyl]thietan-3-amine |
| InChIKey | WIVIQBKVPYDVAK-CEVVRISASA-N |
| SMILES | C1C[C@H]2C[C@H]2C(C1)NC3CSC3 |
Computed by PubChem (NCBI)