CAS 186895-85-2 is the registry number for 4-Amino-1-tert-butyl-3-benzylpyrazolo(3,4-d)pyrimidine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
3-benzyl-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 186895-85-2) is a chemical compound with the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. IUPAC name: 3-benzyl-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: DCRVCTFFEZBXCK-UHFFFAOYSA-N.
| Molecular formula | C16H19N5 |
|---|---|
| Molecular weight | 281.36 g/mol |
| IUPAC name | 3-benzyl-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | DCRVCTFFEZBXCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC=NC(=C2C(=N1)CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)