Products 186907-75-5

CAS 186907-75-5 is the registry number for Allyl 2,2,3,3,3-pentafluoropropyl ether, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

1,1,1,2,2-pentafluoro-3-prop-2-enoxypropane (CAS 186907-75-5) is a chemical compound with the molecular formula C6H7F5O and a molecular weight of 190.11 g/mol. IUPAC name: 1,1,1,2,2-pentafluoro-3-prop-2-enoxypropane. InChIKey: OPCORXXVBOOEID-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7F5O
Molecular weight190.11 g/mol
IUPAC name1,1,1,2,2-pentafluoro-3-prop-2-enoxypropane
InChIKeyOPCORXXVBOOEID-UHFFFAOYSA-N
SMILESC=CCOCC(C(F)(F)F)(F)F

Computed by PubChem (NCBI)