Products 1869080-73-8
CAS 1869080-73-8 is the registry number for 4-(Trifluoromethyl)phenyl 2-bromo-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
[4-(trifluoromethyl)phenyl] 2-bromo-2,2-difluoroacetate (CAS 1869080-73-8) is a chemical compound with the molecular formula C9H4BrF5O2 and a molecular weight of 319.02 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl] 2-bromo-2,2-difluoroacetate. InChIKey: IGBYZBMTASKLBB-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF5O2 |
|---|---|
| Molecular weight | 319.02 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl] 2-bromo-2,2-difluoroacetate |
| InChIKey | IGBYZBMTASKLBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC(=O)C(F)(F)Br |
Computed by PubChem (NCBI)