CAS 186958-58-7 is the registry number for N-Pentafluorophenyldichloromaleimide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,4-dichloro-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione (CAS 186958-58-7) is a chemical compound with the molecular formula C10Cl2F5NO2 and a molecular weight of 332.01 g/mol. IUPAC name: 3,4-dichloro-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione. InChIKey: QQUWZXNLBVBCLD-UHFFFAOYSA-N.
| Molecular formula | C10Cl2F5NO2 |
|---|---|
| Molecular weight | 332.01 g/mol |
| IUPAC name | 3,4-dichloro-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione |
| InChIKey | QQUWZXNLBVBCLD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)N2C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)