CAS 18700-23-7 is the registry number for (1R,5S,6R)-Rel-8-Methyl-8-azabicyclo-(3.2.1)octan-6-ol, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(1R,5S,6R)-8-methyl-8-azabicyclo[3.2.1]octan-6-ol (CAS 18700-23-7) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (1R,5S,6R)-8-methyl-8-azabicyclo[3.2.1]octan-6-ol. InChIKey: PZPVPVJLCPBGRW-GJMOJQLCSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (1R,5S,6R)-8-methyl-8-azabicyclo[3.2.1]octan-6-ol |
| InChIKey | PZPVPVJLCPBGRW-GJMOJQLCSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1[C@@H](C2)O |
Computed by PubChem (NCBI)