CAS 1870019-79-6 is the registry number for 5-(Tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoic acid (CAS 1870019-79-6) is a chemical compound with the molecular formula C11H21BO4 and a molecular weight of 228.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoic acid. InChIKey: MBOSCFXSGAOJKL-UHFFFAOYSA-N.
| Molecular formula | C11H21BO4 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoic acid |
| InChIKey | MBOSCFXSGAOJKL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCCC(=O)O |
Computed by PubChem (NCBI)