Products 1870073-89-4
CAS 1870073-89-4 is the registry number for Bis(1-chloro-2-propyl) phosphate-d12. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Bis(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) hydrogen phosphate (CAS 1870073-89-4) is a chemical compound with the molecular formula C6H13Cl2O4P and a molecular weight of 263.12 g/mol. IUPAC name: bis(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) hydrogen phosphate. InChIKey: ORAAZVDXWSKZHK-BAPREJARSA-N.
| Molecular formula | C6H13Cl2O4P |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | bis(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) hydrogen phosphate |
| InChIKey | ORAAZVDXWSKZHK-BAPREJARSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)OP(=O)(O)OC([2H])(C([2H])([2H])[2H])C([2H])([2H])Cl |
Computed by PubChem (NCBI)