Products 18708-16-2
CAS 18708-16-2 is the registry number for N'-(4-(Dimethylamino)benzylidene)-4-methylbenzenesulfonohydrazide, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methylbenzenesulfonamide (CAS 18708-16-2) is a chemical compound with the molecular formula C16H19N3O2S and a molecular weight of 317.4 g/mol. IUPAC name: N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methylbenzenesulfonamide. InChIKey: GMMHANXVXWEFGR-SFQUDFHCSA-N.
| Molecular formula | C16H19N3O2S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | GMMHANXVXWEFGR-SFQUDFHCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)