Products 187085-44-5

CAS 187085-44-5 is the registry number for 5-Oxo-7-(trimethylsilyl)hept-6-ynoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-oxo-7-trimethylsilylhept-6-ynoic acid (CAS 187085-44-5) is a chemical compound with the molecular formula C10H16O3Si and a molecular weight of 212.32 g/mol. IUPAC name: 5-oxo-7-trimethylsilylhept-6-ynoic acid. InChIKey: WLJBFUIIJRKVGK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O3Si
Molecular weight212.32 g/mol
IUPAC name5-oxo-7-trimethylsilylhept-6-ynoic acid
InChIKeyWLJBFUIIJRKVGK-UHFFFAOYSA-N
SMILESC[Si](C)(C)C#CC(=O)CCCC(=O)O

Computed by PubChem (NCBI)