CAS 1870876-90-6 is the registry number for 3-((1-(Thiophen-2-yl)ethyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-N-(1-thiophen-2-ylethyl)thietan-3-amine (CAS 1870876-90-6) is a chemical compound with the molecular formula C9H13NO2S2 and a molecular weight of 231.3 g/mol. IUPAC name: 1,1-dioxo-N-(1-thiophen-2-ylethyl)thietan-3-amine. InChIKey: MEZPTENIGTZEBB-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S2 |
|---|---|
| Molecular weight | 231.3 g/mol |
| IUPAC name | 1,1-dioxo-N-(1-thiophen-2-ylethyl)thietan-3-amine |
| InChIKey | MEZPTENIGTZEBB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CS1)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)