CAS 187088-67-1 appears in our catalog under these names: Benzoic acid, 4,4'-[[4-(1,1-dimethylethyl)-1,2-phenylene]bis(oxy)]bis-, 98%, 4,4'–((4–(Tert–butyl)–1,2–phenylene)bis(oxy))dibenzoic acid, 4,4′-[[4-(1,1-Dimethylethyl)-1,2-phenylene]bis(oxy)]bis[benzoic acid], 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg.
4-[4-tert-butyl-2-(4-carboxyphenoxy)phenoxy]benzoic acid (CAS 187088-67-1) is a chemical compound with the molecular formula C24H22O6 and a molecular weight of 406.4 g/mol. IUPAC name: 4-[4-tert-butyl-2-(4-carboxyphenoxy)phenoxy]benzoic acid. InChIKey: SMBJWBRTDHDUMR-UHFFFAOYSA-N.
| Molecular formula | C24H22O6 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 4-[4-tert-butyl-2-(4-carboxyphenoxy)phenoxy]benzoic acid |
| InChIKey | SMBJWBRTDHDUMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC2=CC=C(C=C2)C(=O)O)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)