CAS 1870880-09-3 appears in our catalog under these names: Afatinib Impurity 56, Afatinib Impurity 113. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-N-[7-chloro-4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 1870880-09-3) is a chemical compound with the molecular formula C20H18Cl2FN5O and a molecular weight of 434.3 g/mol. IUPAC name: (E)-N-[7-chloro-4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: PXTCXCMNJIXPJR-ONEGZZNKSA-N.
| Molecular formula | C20H18Cl2FN5O |
|---|---|
| Molecular weight | 434.3 g/mol |
| IUPAC name | (E)-N-[7-chloro-4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | PXTCXCMNJIXPJR-ONEGZZNKSA-N |
| SMILES | CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)Cl |
Computed by PubChem (NCBI)