Products 187154-91-2
CAS 187154-91-2 is the registry number for 3-Methylbut-2-en-1-yl (2S)-2-amino-3-methylbutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methylbut-2-enyl (2S)-2-amino-3-methylbutanoate (CAS 187154-91-2) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: 3-methylbut-2-enyl (2S)-2-amino-3-methylbutanoate. InChIKey: IDHBCGXLUHNKFM-VIFPVBQESA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 3-methylbut-2-enyl (2S)-2-amino-3-methylbutanoate |
| InChIKey | IDHBCGXLUHNKFM-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC=C(C)C)N |
Computed by PubChem (NCBI)