CAS 1872434-79-1 appears in our catalog under these names: 5-(2-Thiazolyl)thiophene-2-boronic acid, 95%, 5–(Thiazol–2–yl)thiophene–2–boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 25mg, 5mg.
[5-(1,3-thiazol-2-yl)thiophen-2-yl]boronic acid (CAS 1872434-79-1) is a chemical compound with the molecular formula C7H6BNO2S2 and a molecular weight of 211.1 g/mol. IUPAC name: [5-(1,3-thiazol-2-yl)thiophen-2-yl]boronic acid. InChIKey: PFDACBBKRGXDKO-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO2S2 |
|---|---|
| Molecular weight | 211.1 g/mol |
| IUPAC name | [5-(1,3-thiazol-2-yl)thiophen-2-yl]boronic acid |
| InChIKey | PFDACBBKRGXDKO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C2=NC=CS2)(O)O |
Computed by PubChem (NCBI)