CAS 1872910-94-5 is the registry number for 2,2,2-Trifluoro-1-(3-methyl-1,1-dioxidothiomorpholino)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanone (CAS 1872910-94-5) is a chemical compound with the molecular formula C7H10F3NO3S and a molecular weight of 245.22 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanone. InChIKey: GVFYUALPEWESAX-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO3S |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
| InChIKey | GVFYUALPEWESAX-UHFFFAOYSA-N |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)C(F)(F)F |
Computed by PubChem (NCBI)