CAS 1873303-31-1 appears in our catalog under these names: 1-ISOPROPYL-2-METHYL-1H-BENZIMIDAZOLE-6-BORONIC ACID PINACOL ESTER, 97%, 97%, 1-ISOPROPYL-2-METHYL-1H-BENZIMIDAZOLE-6-BORONIC ACID PINACOL ESTER, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-methyl-1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole (CAS 1873303-31-1) is a chemical compound with the molecular formula C17H25BN2O2 and a molecular weight of 300.2 g/mol. IUPAC name: 2-methyl-1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole. InChIKey: MGNKQVFTRNWSFD-UHFFFAOYSA-N.
| Molecular formula | C17H25BN2O2 |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 2-methyl-1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
| InChIKey | MGNKQVFTRNWSFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=C(N3C(C)C)C |
Computed by PubChem (NCBI)