CAS 18740-59-5 is the registry number for Chlorotribenzylsilane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tribenzyl(chloro)silane (CAS 18740-59-5) is a chemical compound with the molecular formula C21H21ClSi and a molecular weight of 336.9 g/mol. IUPAC name: tribenzyl(chloro)silane. InChIKey: UTXPCJHKADAFBB-UHFFFAOYSA-N.
| Molecular formula | C21H21ClSi |
|---|---|
| Molecular weight | 336.9 g/mol |
| IUPAC name | tribenzyl(chloro)silane |
| InChIKey | UTXPCJHKADAFBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[Si](CC2=CC=CC=C2)(CC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)