Products 187478-96-2
CAS 187478-96-2 is the registry number for 7-CH-dADP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 187478-96-2) is a chemical compound with the molecular formula C11H16N4O9P2 and a molecular weight of 410.21 g/mol. IUPAC name: [(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: PYSINQSNHAOMKT-DJLDLDEBSA-N.
| Molecular formula | C11H16N4O9P2 |
|---|---|
| Molecular weight | 410.21 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | PYSINQSNHAOMKT-DJLDLDEBSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)