CAS 18752-21-1 appears in our catalog under these names: Allyltriphenylsilane, 95%, ALLYLTRIPHENYLSILANE, Allyltriphenylsilane 97%, Allyltriphenylsilane, 97%, 97%, Allyltriphenylsilane, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Triphenyl(prop-2-enyl)silane (CAS 18752-21-1) is a chemical compound with the molecular formula C21H20Si and a molecular weight of 300.5 g/mol. IUPAC name: triphenyl(prop-2-enyl)silane. InChIKey: DXJZZRSMGLGFPW-UHFFFAOYSA-N.
| Molecular formula | C21H20Si |
|---|---|
| Molecular weight | 300.5 g/mol |
| IUPAC name | triphenyl(prop-2-enyl)silane |
| InChIKey | DXJZZRSMGLGFPW-UHFFFAOYSA-N |
| SMILES | C=CC[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)