Products 187533-10-4

CAS 187533-10-4 is the registry number for Z-1,4-Trans-amcha hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-[4-(aminomethyl)cyclohexyl]carbamate;hydrochloride (CAS 187533-10-4) is a chemical compound with the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. IUPAC name: benzyl N-[4-(aminomethyl)cyclohexyl]carbamate;hydrochloride. InChIKey: RUVDEZPQPDTJBK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23ClN2O2
Molecular weight298.81 g/mol
IUPAC namebenzyl N-[4-(aminomethyl)cyclohexyl]carbamate;hydrochloride
InChIKeyRUVDEZPQPDTJBK-UHFFFAOYSA-N
SMILESC1CC(CCC1CN)NC(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)