Products 1876-16-0

CAS 1876-16-0 is the registry number for bis(2-(2-hydroxyethyl)guanidine) sulfuric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-hydroxyethyl)guanidine;sulfuric acid (CAS 1876-16-0) is a chemical compound with the molecular formula C3H11N3O5S and a molecular weight of 201.20 g/mol. IUPAC name: 2-(2-hydroxyethyl)guanidine;sulfuric acid. InChIKey: JXXQSFUWEIFWJY-UHFFFAOYSA-N.

Identity
Molecular formulaC3H11N3O5S
Molecular weight201.20 g/mol
IUPAC name2-(2-hydroxyethyl)guanidine;sulfuric acid
InChIKeyJXXQSFUWEIFWJY-UHFFFAOYSA-N
SMILESC(CO)N=C(N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)