CAS 187668-44-6 appears in our catalog under these names: Cangrelor Impurity 10, 4,6-dichloro-5-nitro-2-((3,3,3-trifluoropropyl)thio)-Pyrimidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4,6-dichloro-5-nitro-2-(3,3,3-trifluoropropylsulfanyl)pyrimidine (CAS 187668-44-6) is a chemical compound with the molecular formula C7H4Cl2F3N3O2S and a molecular weight of 322.09 g/mol. IUPAC name: 4,6-dichloro-5-nitro-2-(3,3,3-trifluoropropylsulfanyl)pyrimidine. InChIKey: OOXSPRVTTSGCQK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N3O2S |
|---|---|
| Molecular weight | 322.09 g/mol |
| IUPAC name | 4,6-dichloro-5-nitro-2-(3,3,3-trifluoropropylsulfanyl)pyrimidine |
| InChIKey | OOXSPRVTTSGCQK-UHFFFAOYSA-N |
| SMILES | C(CSC1=NC(=C(C(=N1)Cl)[N+](=O)[O-])Cl)C(F)(F)F |
Computed by PubChem (NCBI)