Products 1877243-60-1

CAS 1877243-60-1 appears in our catalog under these names: AB–FUBINACA metabolite 3, AB-FUBINACA Metabolite 3. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 1mg, 100mg, 5mg, 50mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid (CAS 1877243-60-1) is a chemical compound with the molecular formula C20H20FN3O3 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid. InChIKey: XWTKFXNTAUXIRK-KRWDZBQOSA-N.

Identity
Molecular formulaC20H20FN3O3
Molecular weight369.4 g/mol
IUPAC name(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid
InChIKeyXWTKFXNTAUXIRK-KRWDZBQOSA-N
SMILESCC(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F

Computed by PubChem (NCBI)