CAS 1877243-60-1 appears in our catalog under these names: AB–FUBINACA metabolite 3, AB-FUBINACA Metabolite 3. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 1mg, 100mg, 5mg, 50mg, 10mg, 25mg.
(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid (CAS 1877243-60-1) is a chemical compound with the molecular formula C20H20FN3O3 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid. InChIKey: XWTKFXNTAUXIRK-KRWDZBQOSA-N.
| Molecular formula | C20H20FN3O3 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid |
| InChIKey | XWTKFXNTAUXIRK-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)