Products 1877308-61-6
CAS 1877308-61-6 appears in our catalog under these names: trans-1-Benzyl-4-methylpyrrolidine-3-methanol, 95%, trans–1–Benzyl–4–methylpyrrolidine–3–methanol, trans-1-Benzyl-4-methylpyrrolidine-3-methanol. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]methanol (CAS 1877308-61-6) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: [(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]methanol. InChIKey: MQIQTRXCBIVWTN-YPMHNXCESA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | [(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]methanol |
| InChIKey | MQIQTRXCBIVWTN-YPMHNXCESA-N |
| SMILES | C[C@@H]1CN(C[C@H]1CO)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)