CAS 187731-26-6 appears in our catalog under these names: Hexyldimethyloctylammonium bromide, 95%, Hexyldimethyloctylammonium Bromide, Hexyldimethyloctylammonium Bromide, >97.0%(T), Hexyldimethyloctylammonium Bromide, 98%, 98%, Hexyldimethyloctylammonium (bromide), 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg, 1 g, 5 g.
Hexyl-dimethyl-octylazanium bromide (CAS 187731-26-6) is a chemical compound with the molecular formula C16H36BrN and a molecular weight of 322.37 g/mol. IUPAC name: hexyl-dimethyl-octylazanium bromide. InChIKey: KIEOLZRKTOBVMX-UHFFFAOYSA-M.
| Molecular formula | C16H36BrN |
|---|---|
| Molecular weight | 322.37 g/mol |
| IUPAC name | hexyl-dimethyl-octylazanium bromide |
| InChIKey | KIEOLZRKTOBVMX-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](C)(C)CCCCCC.[Br-] |
Computed by PubChem (NCBI)