CAS 1877666-09-5 is the registry number for 3-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)-5-iodobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodobenzoic acid (CAS 1877666-09-5) is a chemical compound with the molecular formula C22H16INO4 and a molecular weight of 485.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodobenzoic acid. InChIKey: DIVUFXUPRMYNEX-UHFFFAOYSA-N.
| Molecular formula | C22H16INO4 |
|---|---|
| Molecular weight | 485.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodobenzoic acid |
| InChIKey | DIVUFXUPRMYNEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=CC(=C4)C(=O)O)I |
Computed by PubChem (NCBI)