CAS 1878217-46-9 appears in our catalog under these names: Methyl 4-bromo-2,3-difluoro-5-iodobenzoate, 95%, methyl 4-bromo-2,3-difluoro-5-iodobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-bromo-2,3-difluoro-5-iodobenzoate (CAS 1878217-46-9) is a chemical compound with the molecular formula C8H4BrF2IO2 and a molecular weight of 376.92 g/mol. IUPAC name: methyl 4-bromo-2,3-difluoro-5-iodobenzoate. InChIKey: CSBWTYPGEVRENA-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2IO2 |
|---|---|
| Molecular weight | 376.92 g/mol |
| IUPAC name | methyl 4-bromo-2,3-difluoro-5-iodobenzoate |
| InChIKey | CSBWTYPGEVRENA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)Br)I |
Computed by PubChem (NCBI)