CAS 187868-29-7 is the registry number for (4-METHYLTHIOPHENYL)METHYL PHENYL SULF&, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Methyl-(4-methylsulfanylphenyl)-phenylsulfanium;trifluoromethanesulfonate (CAS 187868-29-7) is a chemical compound with the molecular formula C15H15F3O3S3 and a molecular weight of 396.5 g/mol. IUPAC name: methyl-(4-methylsulfanylphenyl)-phenylsulfanium;trifluoromethanesulfonate. InChIKey: OEMQHKIRYKSFQC-UHFFFAOYSA-M.
| Molecular formula | C15H15F3O3S3 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | methyl-(4-methylsulfanylphenyl)-phenylsulfanium;trifluoromethanesulfonate |
| InChIKey | OEMQHKIRYKSFQC-UHFFFAOYSA-M |
| SMILES | CSC1=CC=C(C=C1)[S+](C)C2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)