CAS 1879026-24-0 appears in our catalog under these names: 2-Bromo-6-fluoro-3-(methylthio)benzaldehyde, 95%, 2-Bromo-6-fluoro-3-(methylthio)benzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-bromo-6-fluoro-3-methylsulfanylbenzaldehyde (CAS 1879026-24-0) is a chemical compound with the molecular formula C8H6BrFOS and a molecular weight of 249.10 g/mol. IUPAC name: 2-bromo-6-fluoro-3-methylsulfanylbenzaldehyde. InChIKey: WDLMHRMVUBSANP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFOS |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-methylsulfanylbenzaldehyde |
| InChIKey | WDLMHRMVUBSANP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)F)C=O)Br |
Computed by PubChem (NCBI)