CAS 1879038-73-9 is the registry number for 5-(Diphenylmethylsulfinylmethyl)-1,3-thiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g, 50g.
5-(benzhydrylsulfinylmethyl)-1,3-thiazole (CAS 1879038-73-9) is a chemical compound with the molecular formula C17H15NOS2 and a molecular weight of 313.4 g/mol. IUPAC name: 5-(benzhydrylsulfinylmethyl)-1,3-thiazole. InChIKey: VBBBWHDWYLUSEL-UHFFFAOYSA-N.
| Molecular formula | C17H15NOS2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 5-(benzhydrylsulfinylmethyl)-1,3-thiazole |
| InChIKey | VBBBWHDWYLUSEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)S(=O)CC3=CN=CS3 |
Computed by PubChem (NCBI)