CAS 1879225-20-3 is the registry number for 1-(2,2-dibromovinyl)-3,5-difluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,2-dibromoethenyl)-3,5-difluorobenzene (CAS 1879225-20-3) is a chemical compound with the molecular formula C8H4Br2F2 and a molecular weight of 297.92 g/mol. IUPAC name: 1-(2,2-dibromoethenyl)-3,5-difluorobenzene. InChIKey: GXUNBCXQZPWTCX-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2 |
|---|---|
| Molecular weight | 297.92 g/mol |
| IUPAC name | 1-(2,2-dibromoethenyl)-3,5-difluorobenzene |
| InChIKey | GXUNBCXQZPWTCX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C=C(Br)Br |
Computed by PubChem (NCBI)