Products 1879247-23-0
CAS 1879247-23-0 is the registry number for Methyl 3-bromo-4-[[methyl(phenylmethyl)amino]methyl]benzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-[[benzyl(methyl)amino]methyl]-3-bromobenzoate (CAS 1879247-23-0) is a chemical compound with the molecular formula C17H18BrNO2 and a molecular weight of 348.2 g/mol. IUPAC name: methyl 4-[[benzyl(methyl)amino]methyl]-3-bromobenzoate. InChIKey: AXAXVXZNOUZIQU-UHFFFAOYSA-N.
| Molecular formula | C17H18BrNO2 |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | methyl 4-[[benzyl(methyl)amino]methyl]-3-bromobenzoate |
| InChIKey | AXAXVXZNOUZIQU-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)CC2=C(C=C(C=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)