CAS 187949-02-6 appears in our catalog under these names: Albaconazole, 95%, Albaconazole, >95% (HPLC), Albaconazole/ 100%, Albaconazole, 99.76% ,, 99.76% ,, Albaconazole. Offered by: Combi-blocks, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg.
7-chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]quinazolin-4-one (CAS 187949-02-6) is a chemical compound with the molecular formula C20H16ClF2N5O2 and a molecular weight of 431.8 g/mol. IUPAC name: 7-chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]quinazolin-4-one. InChIKey: UHIXWHUVLCAJQL-MPBGBICISA-N.
| Molecular formula | C20H16ClF2N5O2 |
|---|---|
| Molecular weight | 431.8 g/mol |
| IUPAC name | 7-chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]quinazolin-4-one |
| InChIKey | UHIXWHUVLCAJQL-MPBGBICISA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)N3C=NC4=C(C3=O)C=CC(=C4)Cl |
Computed by PubChem (NCBI)