CAS 1880080-96-5 is the registry number for 3-((1-(Furan-3-yl)ethyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[1-(furan-3-yl)ethyl]-1,1-dioxothietan-3-amine (CAS 1880080-96-5) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: N-[1-(furan-3-yl)ethyl]-1,1-dioxothietan-3-amine. InChIKey: QGGRLVZRBYRWLA-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | N-[1-(furan-3-yl)ethyl]-1,1-dioxothietan-3-amine |
| InChIKey | QGGRLVZRBYRWLA-UHFFFAOYSA-N |
| SMILES | CC(C1=COC=C1)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)