Products 188017-02-9

CAS 188017-02-9 is the registry number for 3-Methoxy-4,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-methoxy-4,5-dimethylbenzoic acid (CAS 188017-02-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-methoxy-4,5-dimethylbenzoic acid. InChIKey: ZINHOYQQTYOYRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC name3-methoxy-4,5-dimethylbenzoic acid
InChIKeyZINHOYQQTYOYRJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C)OC)C(=O)O

Computed by PubChem (NCBI)