CAS 188017-02-9 is the registry number for 3-Methoxy-4,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-4,5-dimethylbenzoic acid (CAS 188017-02-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-methoxy-4,5-dimethylbenzoic acid. InChIKey: ZINHOYQQTYOYRJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-methoxy-4,5-dimethylbenzoic acid |
| InChIKey | ZINHOYQQTYOYRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)OC)C(=O)O |
Computed by PubChem (NCBI)