CAS 188062-33-1 is the registry number for 2,2-Dimethylpropyl 3-bromobenzene-1-sulfonate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-dimethylpropyl 3-bromobenzenesulfonate (CAS 188062-33-1) is a chemical compound with the molecular formula C11H15BrO3S and a molecular weight of 307.21 g/mol. IUPAC name: 2,2-dimethylpropyl 3-bromobenzenesulfonate. InChIKey: VHQOAOCBRZZNBS-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO3S |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 2,2-dimethylpropyl 3-bromobenzenesulfonate |
| InChIKey | VHQOAOCBRZZNBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COS(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)