CAS 188113-72-6 is the registry number for Eletriptan Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(E)-2-(benzenesulfonyl)ethenyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole (CAS 188113-72-6) is a chemical compound with the molecular formula C22H24N2O2S and a molecular weight of 380.5 g/mol. IUPAC name: 5-[(E)-2-(benzenesulfonyl)ethenyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole. InChIKey: MJICWWOZPCLNBP-XSSIKURBSA-N.
| Molecular formula | C22H24N2O2S |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 5-[(E)-2-(benzenesulfonyl)ethenyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
| InChIKey | MJICWWOZPCLNBP-XSSIKURBSA-N |
| SMILES | CN1CCC[C@@H]1CC2=CNC3=C2C=C(C=C3)/C=C/S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)