CAS 188114-98-9 appears in our catalog under these names: Sivelestat Impurity 4, Sivelestat sodium Impurity F. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoic acid (CAS 188114-98-9) is a chemical compound with the molecular formula C18H19NO6S and a molecular weight of 377.4 g/mol. IUPAC name: 2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoic acid. InChIKey: YERDPJCYIUPTKB-UHFFFAOYSA-N.
| Molecular formula | C18H19NO6S |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoic acid |
| InChIKey | YERDPJCYIUPTKB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)