Products 1881167-15-2

CAS 1881167-15-2 is the registry number for 4-(2-(Benzyloxy)ethoxy)-3-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

3-methoxy-4-(2-phenylmethoxyethoxy)benzoic acid (CAS 1881167-15-2) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: 3-methoxy-4-(2-phenylmethoxyethoxy)benzoic acid. InChIKey: ONXMZFQZBQWRQA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18O5
Molecular weight302.32 g/mol
IUPAC name3-methoxy-4-(2-phenylmethoxyethoxy)benzoic acid
InChIKeyONXMZFQZBQWRQA-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)O)OCCOCC2=CC=CC=C2

Computed by PubChem (NCBI)