CAS 1881180-73-9 is the registry number for N-(2,3-Dihydro-1H-inden-5-yl)thietan-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,3-dihydro-1H-inden-5-yl)thietan-3-amine (CAS 1881180-73-9) is a chemical compound with the molecular formula C12H15NS and a molecular weight of 205.32 g/mol. IUPAC name: N-(2,3-dihydro-1H-inden-5-yl)thietan-3-amine. InChIKey: MMLZAQKVXGYDSO-UHFFFAOYSA-N.
| Molecular formula | C12H15NS |
|---|---|
| Molecular weight | 205.32 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-inden-5-yl)thietan-3-amine |
| InChIKey | MMLZAQKVXGYDSO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC3CSC3 |
Computed by PubChem (NCBI)