Products 1881221-47-1
CAS 1881221-47-1 appears in our catalog under these names: BCN–PEG4–acid, BCN-PEG4-acid 98%, BCN-PEG4-acid, 98%, 98%, endo-BCN-PEG4-acid, 99.27%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 50mg, 100mg, 50 mg, 250 mg, 1 g, 100 mg.
3-[2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1881221-47-1) is a chemical compound with the molecular formula C22H35NO8 and a molecular weight of 441.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MOPSTLKSTPBGBX-YOFSQIOKSA-N.
| Molecular formula | C22H35NO8 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MOPSTLKSTPBGBX-YOFSQIOKSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)NCCOCCOCCOCCOCCC(=O)O)CCC#C1 |
Computed by PubChem (NCBI)