Products 1881270-27-4
CAS 1881270-27-4 is the registry number for CAY10706. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
(1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one (CAS 1881270-27-4) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one. InChIKey: FVCYSHIIMOFVLY-ZIRGRKGMSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one |
| InChIKey | FVCYSHIIMOFVLY-ZIRGRKGMSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)/C=C/C(=O)/C=C/C2=CC(=C(C=C2)O)OC)C |
Computed by PubChem (NCBI)